C13H26N4O2 — CID 67674153
[1-(1-carbamimidoylpiperidin-3-yl)-2,2-dimethylpropyl] N-methylcarbamate (PubChem CID 67674153) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is [1-(1-carbamimidoylpiperidin-3-yl)-2,2-dimethylpropyl] N-methylcarbamate.
| Compound Name | [1-(1-carbamimidoylpiperidin-3-yl)-2,2-dimethylpropyl] N-methylcarbamate |
|---|---|
| PubChem CID | 67674153 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | [1-(1-carbamimidoylpiperidin-3-yl)-2,2-dimethylpropyl] N-methylcarbamate |
| SMILES | [H]/N=C(\N)N1CCCC(C(OC(=O)NC)C(C)(C)C)C1 |
| InChI | InChI=1S/C13H26N4O2/c1-13(2,3)10(19-12(18)16-4)9-6-5-7-17(8-9)11(14)15/h9-10H,5-8H2,1-4H3,(H3,14,15)(H,16,18) |
| InChIKey | RWQGKDHFQOVQBR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|