C19H32O3 — CID 67675377
1-(4-octylphenoxy)pentane-1,5-diol (PubChem CID 67675377) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 1-(4-octylphenoxy)pentane-1,5-diol.
| Compound Name | 1-(4-octylphenoxy)pentane-1,5-diol |
|---|---|
| PubChem CID | 67675377 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 1-(4-octylphenoxy)pentane-1,5-diol |
| SMILES | CCCCCCCCc1ccc(OC(O)CCCCO)cc1 |
| InChI | InChI=1S/C19H32O3/c1-2-3-4-5-6-7-10-17-12-14-18(15-13-17)22-19(21)11-8-9-16-20/h12-15,19-21H,2-11,16H2,1H3 |
| InChIKey | TTZJXRVDKDEVLX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|