C60H103NO5 — CID 169242939
[4-[6-[6-[4-(2-hexyldecanoyloxy)phenyl]hexyl-(4-hydroxybutyl)amino]hexyl]phenyl] 2-hexyldecanoate (PubChem CID 169242939) has the molecular formula C60H103NO5 and a molecular weight of 918.49 g/mol. Its IUPAC name is [4-[6-[6-[4-(2-hexyldecanoyloxy)phenyl]hexyl-(4-hydroxybutyl)amino]hexyl]phenyl] 2-hexyldecanoate.
| Compound Name | [4-[6-[6-[4-(2-hexyldecanoyloxy)phenyl]hexyl-(4-hydroxybutyl)amino]hexyl]phenyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 169242939 |
| Molecular Formula | C60H103NO5 |
| Molecular Weight | 918.49 g/mol |
| Exact Mass | 917.78 |
| IUPAC Name | [4-[6-[6-[4-(2-hexyldecanoyloxy)phenyl]hexyl-(4-hydroxybutyl)amino]hexyl]phenyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)Oc1ccc(CCCCCCN(CCCCO)CCCCCCc2ccc(OC(=O)C(CCCCCC)CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C60H103NO5/c1-5-9-13-17-19-29-39-55(37-27-15-11-7-3)59(63)65-57-45-41-53(42-46-57)35-25-21-23-31-49-61(51-33-34-52-62)50-32-24-22-26-36-54-43-47-58(48-44-54)66-60(64)56(38-28-16-12-8-4)40-30-20-18-14-10-6-2/h41-48,55-56,62H,5-40,49-52H2,1-4H3 |
| InChIKey | DUTRFUUILXWDOW-UHFFFAOYSA-N |
| XLogP | 17.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.49 |
| LogP ≤ 5 | 17.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|