C15H20F3NO4 — CID 67675380
1-[3-(trifluoromethyl)phenoxy]butyl N-(2-hydroxypropyl)carbamate (PubChem CID 67675380) has the molecular formula C15H20F3NO4 and a molecular weight of 335.32 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenoxy]butyl N-(2-hydroxypropyl)carbamate.
| Compound Name | 1-[3-(trifluoromethyl)phenoxy]butyl N-(2-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 67675380 |
| Molecular Formula | C15H20F3NO4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenoxy]butyl N-(2-hydroxypropyl)carbamate |
| SMILES | CCCC(OC(=O)NCC(C)O)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO4/c1-3-5-13(23-14(21)19-9-10(2)20)22-12-7-4-6-11(8-12)15(16,17)18/h4,6-8,10,13,20H,3,5,9H2,1-2H3,(H,19,21) |
| InChIKey | SLCIPBFGAPGZID-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|