C30H38O — CID 67677298
1-(but-3-enoxymethyl)-4-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]but-3-enyl]phenyl]benzene (PubChem CID 67677298) has the molecular formula C30H38O and a molecular weight of 414.63 g/mol. Its IUPAC name is 1-(but-3-enoxymethyl)-4-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]but-3-enyl]phenyl]benzene.
| Compound Name | 1-(but-3-enoxymethyl)-4-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]but-3-enyl]phenyl]benzene |
|---|---|
| PubChem CID | 67677298 |
| Molecular Formula | C30H38O |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | 1-(but-3-enoxymethyl)-4-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]but-3-enyl]phenyl]benzene |
| SMILES | C=CCCOCc1ccc(-c2ccc(CCC=CC3CCC(/C=C/C)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H38O/c1-3-5-23-31-24-28-17-21-30(22-18-28)29-19-15-27(16-20-29)10-7-6-9-26-13-11-25(8-4-2)12-14-26/h3-4,6,8-9,15-22,25-26H,1,5,7,10-14,23-24H2,2H3/b8-4+,9-6? |
| InChIKey | WMONDIPHJHSIRQ-SRMIVPTFSA-N |
| XLogP | 8.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|