C21H30O — CID 67677311
1-(pent-4-enoxymethyl)-4-[4-[(Z)-prop-1-enyl]cyclohexyl]benzene (PubChem CID 67677311) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-(pent-4-enoxymethyl)-4-[4-[(Z)-prop-1-enyl]cyclohexyl]benzene.
| Compound Name | 1-(pent-4-enoxymethyl)-4-[4-[(Z)-prop-1-enyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 67677311 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1-(pent-4-enoxymethyl)-4-[4-[(Z)-prop-1-enyl]cyclohexyl]benzene |
| SMILES | C=CCCCOCc1ccc(C2CCC(/C=C\C)CC2)cc1 |
| InChI | InChI=1S/C21H30O/c1-3-5-6-16-22-17-19-10-14-21(15-11-19)20-12-8-18(7-4-2)9-13-20/h3-4,7,10-11,14-15,18,20H,1,5-6,8-9,12-13,16-17H2,2H3/b7-4- |
| InChIKey | IWOYDMNDDWADLQ-DAXSKMNVSA-N |
| XLogP | 6.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|