C30H48O — CID 67678810
17-[(E)-5,6-dimethylhept-3-en-2-yl]-3-ethoxy-10,13-dimethyl-2,3,4,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 67678810) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is 17-[(E)-5,6-dimethylhept-3-en-2-yl]-3-ethoxy-10,13-dimethyl-2,3,4,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 17-[(E)-5,6-dimethylhept-3-en-2-yl]-3-ethoxy-10,13-dimethyl-2,3,4,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 67678810 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | 17-[(E)-5,6-dimethylhept-3-en-2-yl]-3-ethoxy-10,13-dimethyl-2,3,4,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCOC1CCC2(C)C(=CCC3=C2CCC2(C)C3CCC2C(C)/C=C/C(C)C(C)C)C1 |
| InChI | InChI=1S/C30H48O/c1-8-31-24-15-17-29(6)23(19-24)11-12-25-27-14-13-26(30(27,7)18-16-28(25)29)22(5)10-9-21(4)20(2)3/h9-11,20-22,24,26-27H,8,12-19H2,1-7H3/b10-9+ |
| InChIKey | UMCSYRDRMHLWLU-MDZDMXLPSA-N |
| XLogP | 8.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|