C27H41NO3 — CID 67680370
(3S,5S,7R,8S,9S,10S,13R,14S,17R)-17-[4-(dimethylamino)phenyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,7,14-triol (PubChem CID 67680370) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is (3S,5S,7R,8S,9S,10S,13R,14S,17R)-17-[4-(dimethylamino)phenyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,7,14-triol.
| Compound Name | (3S,5S,7R,8S,9S,10S,13R,14S,17R)-17-[4-(dimethylamino)phenyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,7,14-triol |
|---|---|
| PubChem CID | 67680370 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | (3S,5S,7R,8S,9S,10S,13R,14S,17R)-17-[4-(dimethylamino)phenyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,7,14-triol |
| SMILES | CN(C)c1ccc([C@H]2CC[C@]3(O)[C@@H]4[C@H](O)C[C@@H]5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C27H41NO3/c1-25-12-9-20(29)15-18(25)16-23(30)24-22(25)10-13-26(2)21(11-14-27(24,26)31)17-5-7-19(8-6-17)28(3)4/h5-8,18,20-24,29-31H,9-16H2,1-4H3/t18-,20-,21+,22-,23+,24-,25-,26+,27-/m0/s1 |
| InChIKey | YMKCMUPHCVJDGK-ZCZMDKGTSA-N |
| XLogP | 4.33 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|