C9H19NSi — CID 67682981
1,2,4-trimethyl-2-prop-2-enylazasilolidine (PubChem CID 67682981) has the molecular formula C9H19NSi and a molecular weight of 169.34 g/mol. Its IUPAC name is 1,2,4-trimethyl-2-prop-2-enylazasilolidine.
| Compound Name | 1,2,4-trimethyl-2-prop-2-enylazasilolidine |
|---|---|
| PubChem CID | 67682981 |
| Molecular Formula | C9H19NSi |
| Molecular Weight | 169.34 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 1,2,4-trimethyl-2-prop-2-enylazasilolidine |
| SMILES | C=CC[Si]1(C)CC(C)CN1C |
| InChI | InChI=1S/C9H19NSi/c1-5-6-11(4)8-9(2)7-10(11)3/h5,9H,1,6-8H2,2-4H3 |
| InChIKey | LFHRIENCOVAJTP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|