About 2-amino-6-anilinobenzoic acid
2-amino-6-anilinobenzoic acid (PubChem CID 67684436) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-amino-6-anilinobenzoic acid.
Molecular Properties
| Compound Name | 2-amino-6-anilinobenzoic acid |
| PubChem CID | 67684436 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-amino-6-anilinobenzoic acid |
| SMILES | Nc1cccc(Nc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C13H12N2O2/c14-10-7-4-8-11(12(10)13(16)17)15-9-5-2-1-3-6-9/h1-8,15H,14H2,(H,16,17) |
| InChIKey | TUMPLMJXGKJKTP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-anilinobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-anilinobenzoic acid?
The IUPAC name of 2-amino-6-anilinobenzoic acid (CID 67684436) is 2-amino-6-anilinobenzoic acid.
What is the SMILES notation for 2-amino-6-anilinobenzoic acid?
The canonical SMILES for 2-amino-6-anilinobenzoic acid is Nc1cccc(Nc2ccccc2)c1C(=O)O.
What is the InChIKey of 2-amino-6-anilinobenzoic acid?
The InChIKey is TUMPLMJXGKJKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c14-10-7-4-8-11(12(10)13(16)17)15-9-5-2-1-3-6-9/h1-8,15H,14H2,(H,16,17).
What are the key properties of 2-amino-6-anilinobenzoic acid?
2-amino-6-anilinobenzoic acid has a molecular weight of 228.25 g/mol, XLogP of 2.71, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-anilinobenzoic acid is sourced from PubChem (CID 67684436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).