2-acetyloxynaphthalene-1,8-dicarboxylic acid

C14H10O6 — CID 67684685

IUPAC2-acetyloxynaphthalene-1,8-dicarboxylic acid
SMILESCC(=O)Oc1ccc2cccc(C(=O)O)c2c1C(=O)O
InChIInChI=1S/C14H10O6/c1-7(15)20-10-6-5-8-3-2-4-9(13(16)17)11(8)12(10)14(18)19/h2-6H,1H3,(H,16,17)(H,18,19)
InChIKeyHZQOOBIYMTUQEM-UHFFFAOYSA-N
MW274.23 g/mol
LogP2.16
Rot. Bonds3

About 2-acetyloxynaphthalene-1,8-dicarboxylic acid

2-acetyloxynaphthalene-1,8-dicarboxylic acid (PubChem CID 67684685) has the molecular formula C14H10O6 and a molecular weight of 274.23 g/mol. Its IUPAC name is 2-acetyloxynaphthalene-1,8-dicarboxylic acid.

Molecular Properties

Compound Name2-acetyloxynaphthalene-1,8-dicarboxylic acid
PubChem CID67684685
Molecular FormulaC14H10O6
Molecular Weight274.23 g/mol
Exact Mass274.05
IUPAC Name2-acetyloxynaphthalene-1,8-dicarboxylic acid
SMILESCC(=O)Oc1ccc2cccc(C(=O)O)c2c1C(=O)O
InChIInChI=1S/C14H10O6/c1-7(15)20-10-6-5-8-3-2-4-9(13(16)17)11(8)12(10)14(18)19/h2-6H,1H3,(H,16,17)(H,18,19)
InChIKeyHZQOOBIYMTUQEM-UHFFFAOYSA-N
XLogP2.16
TPSA100.90 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.23
LogP ≤ 52.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 2-acetyloxynaphthalene-1,8-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyloxynaphthalene-1,8-dicarboxylic acid?
The IUPAC name of 2-acetyloxynaphthalene-1,8-dicarboxylic acid (CID 67684685) is 2-acetyloxynaphthalene-1,8-dicarboxylic acid.
What is the SMILES notation for 2-acetyloxynaphthalene-1,8-dicarboxylic acid?
The canonical SMILES for 2-acetyloxynaphthalene-1,8-dicarboxylic acid is CC(=O)Oc1ccc2cccc(C(=O)O)c2c1C(=O)O.
What is the InChIKey of 2-acetyloxynaphthalene-1,8-dicarboxylic acid?
The InChIKey is HZQOOBIYMTUQEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O6/c1-7(15)20-10-6-5-8-3-2-4-9(13(16)17)11(8)12(10)14(18)19/h2-6H,1H3,(H,16,17)(H,18,19).
What are the key properties of 2-acetyloxynaphthalene-1,8-dicarboxylic acid?
2-acetyloxynaphthalene-1,8-dicarboxylic acid has a molecular weight of 274.23 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxynaphthalene-1,8-dicarboxylic acid is sourced from PubChem (CID 67684685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).