C17H20O4 — CID 67684924
1-ethyl-3-[(3-methoxyphenyl)methyl]-2-oxobicyclo[3.1.0]hexane-6-carboxylic acid (PubChem CID 67684924) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-ethyl-3-[(3-methoxyphenyl)methyl]-2-oxobicyclo[3.1.0]hexane-6-carboxylic acid.
| Compound Name | 1-ethyl-3-[(3-methoxyphenyl)methyl]-2-oxobicyclo[3.1.0]hexane-6-carboxylic acid |
|---|---|
| PubChem CID | 67684924 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-ethyl-3-[(3-methoxyphenyl)methyl]-2-oxobicyclo[3.1.0]hexane-6-carboxylic acid |
| SMILES | CCC12C(=O)C(Cc3cccc(OC)c3)CC1C2C(=O)O |
| InChI | InChI=1S/C17H20O4/c1-3-17-13(14(17)16(19)20)9-11(15(17)18)7-10-5-4-6-12(8-10)21-2/h4-6,8,11,13-14H,3,7,9H2,1-2H3,(H,19,20) |
| InChIKey | ZZGYSIXWCZXIMT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |