C21H16FNO4 — CID 67685145
5-[[2-(2-fluorophenyl)-5-methoxyindol-1-yl]methyl]furan-2-carboxylic acid (PubChem CID 67685145) has the molecular formula C21H16FNO4 and a molecular weight of 365.36 g/mol. Its IUPAC name is 5-[[2-(2-fluorophenyl)-5-methoxyindol-1-yl]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-(2-fluorophenyl)-5-methoxyindol-1-yl]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 67685145 |
| Molecular Formula | C21H16FNO4 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 5-[[2-(2-fluorophenyl)-5-methoxyindol-1-yl]methyl]furan-2-carboxylic acid |
| SMILES | COc1ccc2c(c1)cc(-c1ccccc1F)n2Cc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C21H16FNO4/c1-26-14-6-8-18-13(10-14)11-19(16-4-2-3-5-17(16)22)23(18)12-15-7-9-20(27-15)21(24)25/h2-11H,12H2,1H3,(H,24,25) |
| InChIKey | BSXPMVRYTAZBFC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |