C9H6Cl2N4O2 — CID 67685287
N-(2,6-dichloro-4-nitrophenyl)-4H-imidazol-2-amine (PubChem CID 67685287) has the molecular formula C9H6Cl2N4O2 and a molecular weight of 273.08 g/mol. Its IUPAC name is N-(2,6-dichloro-4-nitrophenyl)-4H-imidazol-2-amine.
| Compound Name | N-(2,6-dichloro-4-nitrophenyl)-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 67685287 |
| Molecular Formula | C9H6Cl2N4O2 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | N-(2,6-dichloro-4-nitrophenyl)-4H-imidazol-2-amine |
| SMILES | O=[N+]([O-])c1cc(Cl)c(NC2=NCC=N2)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2N4O2/c10-6-3-5(15(16)17)4-7(11)8(6)14-9-12-1-2-13-9/h1,3-4H,2H2,(H,13,14) |
| InChIKey | UKASPBMOUQPNLT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|