C19H23N3O5 — CID 67686896
ethyl 2-[1-[(4-cyanobenzoyl)carbamoyl]piperidin-4-yl]-2-methoxyacetate (PubChem CID 67686896) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is ethyl 2-[1-[(4-cyanobenzoyl)carbamoyl]piperidin-4-yl]-2-methoxyacetate.
| Compound Name | ethyl 2-[1-[(4-cyanobenzoyl)carbamoyl]piperidin-4-yl]-2-methoxyacetate |
|---|---|
| PubChem CID | 67686896 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | ethyl 2-[1-[(4-cyanobenzoyl)carbamoyl]piperidin-4-yl]-2-methoxyacetate |
| SMILES | CCOC(=O)C(OC)C1CCN(C(=O)NC(=O)c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C19H23N3O5/c1-3-27-18(24)16(26-2)14-8-10-22(11-9-14)19(25)21-17(23)15-6-4-13(12-20)5-7-15/h4-7,14,16H,3,8-11H2,1-2H3,(H,21,23,25) |
| InChIKey | CFEYGLIDZVXAJM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |