C22H31N — CID 67687244
4-(3,3-dimethyl-2-phenyloctyl)aniline (PubChem CID 67687244) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is 4-(3,3-dimethyl-2-phenyloctyl)aniline.
| Compound Name | 4-(3,3-dimethyl-2-phenyloctyl)aniline |
|---|---|
| PubChem CID | 67687244 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 4-(3,3-dimethyl-2-phenyloctyl)aniline |
| SMILES | CCCCCC(C)(C)C(Cc1ccc(N)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H31N/c1-4-5-9-16-22(2,3)21(19-10-7-6-8-11-19)17-18-12-14-20(23)15-13-18/h6-8,10-15,21H,4-5,9,16-17,23H2,1-3H3 |
| InChIKey | NZTGTCWDIJWLKU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|