C40H32F4O4 — CID 67687616
5-(4-butoxyphenyl)-5-(4-fluorophenyl)-21,21-dimethyl-10-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene-17-carboxylic acid (PubChem CID 67687616) has the molecular formula C40H32F4O4 and a molecular weight of 652.68 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-5-(4-fluorophenyl)-21,21-dimethyl-10-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene-17-carboxylic acid.
| Compound Name | 5-(4-butoxyphenyl)-5-(4-fluorophenyl)-21,21-dimethyl-10-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene-17-carboxylic acid |
|---|---|
| PubChem CID | 67687616 |
| Molecular Formula | C40H32F4O4 |
| Molecular Weight | 652.68 g/mol |
| Exact Mass | 652.22 |
| IUPAC Name | 5-(4-butoxyphenyl)-5-(4-fluorophenyl)-21,21-dimethyl-10-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene-17-carboxylic acid |
| SMILES | CCCCOc1ccc(C2(c3ccc(F)cc3)C=Cc3c4c(c5ccc(C(F)(F)F)cc5c3O2)-c2cc(C(=O)O)ccc2C4(C)C)cc1 |
| InChI | InChI=1S/C40H32F4O4/c1-4-5-20-47-28-14-9-25(10-15-28)39(24-7-12-27(41)13-8-24)19-18-30-35-34(32-21-23(37(45)46)6-17-33(32)38(35,2)3)29-16-11-26(40(42,43)44)22-31(29)36(30)48-39/h6-19,21-22H,4-5,20H2,1-3H3,(H,45,46) |
| InChIKey | IYPCYFATEMDPLS-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.68 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|