C10H19NO2 — CID 67689525
N,N-diethylethanamine;3-methyloxet-2-one (PubChem CID 67689525) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N,N-diethylethanamine;3-methyloxet-2-one.
| Compound Name | N,N-diethylethanamine;3-methyloxet-2-one |
|---|---|
| PubChem CID | 67689525 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N,N-diethylethanamine;3-methyloxet-2-one |
| SMILES | CC1=COC1=O.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C4H4O2/c1-4-7(5-2)6-3;1-3-2-6-4(3)5/h4-6H2,1-3H3;2H,1H3 |
| InChIKey | UUJHBOURDUISDJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |