About N,N-diethylethanamine;3-methyloxet-2-one
N,N-diethylethanamine;3-methyloxet-2-one (PubChem CID 67689525) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is N,N-diethylethanamine;3-methyloxet-2-one.
Molecular Properties
| Compound Name | N,N-diethylethanamine;3-methyloxet-2-one |
| PubChem CID | 67689525 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N,N-diethylethanamine;3-methyloxet-2-one |
| SMILES | CC1=COC1=O.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C4H4O2/c1-4-7(5-2)6-3;1-3-2-6-4(3)5/h4-6H2,1-3H3;2H,1H3 |
| InChIKey | UUJHBOURDUISDJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethylethanamine;3-methyloxet-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;3-methyloxet-2-one?
The IUPAC name of N,N-diethylethanamine;3-methyloxet-2-one (CID 67689525) is N,N-diethylethanamine;3-methyloxet-2-one.
What is the SMILES notation for N,N-diethylethanamine;3-methyloxet-2-one?
The canonical SMILES for N,N-diethylethanamine;3-methyloxet-2-one is CC1=COC1=O.CCN(CC)CC.
What is the InChIKey of N,N-diethylethanamine;3-methyloxet-2-one?
The InChIKey is UUJHBOURDUISDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H4O2/c1-4-7(5-2)6-3;1-3-2-6-4(3)5/h4-6H2,1-3H3;2H,1H3.
What are the key properties of N,N-diethylethanamine;3-methyloxet-2-one?
N,N-diethylethanamine;3-methyloxet-2-one has a molecular weight of 185.27 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;3-methyloxet-2-one is sourced from PubChem (CID 67689525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).