C27H39N3O3 — CID 67690617
2-[[2-benzyl-1-hydroxy-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]propyl]amino]-N,N-dimethylacetamide (PubChem CID 67690617) has the molecular formula C27H39N3O3 and a molecular weight of 453.63 g/mol. Its IUPAC name is 2-[[2-benzyl-1-hydroxy-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]propyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[2-benzyl-1-hydroxy-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]propyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 67690617 |
| Molecular Formula | C27H39N3O3 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | 2-[[2-benzyl-1-hydroxy-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]propyl]amino]-N,N-dimethylacetamide |
| SMILES | CC1CN(CC(Cc2ccccc2)C(O)NCC(=O)N(C)C)CCC1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C27H39N3O3/c1-20-18-30(14-13-27(20,2)23-11-8-12-24(31)16-23)19-22(15-21-9-6-5-7-10-21)26(33)28-17-25(32)29(3)4/h5-12,16,20,22,26,28,31,33H,13-15,17-19H2,1-4H3 |
| InChIKey | MUQSUPZGKQSYDQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|