C34H48N6O5S — CID 67692309
ethyl (2R)-1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-[3-(dimethylamino)propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]sulfonylamino]propanoyl]-4-methyl-3,6-dihydro-2H-pyridine-2-carboxylate (PubChem CID 67692309) has the molecular formula C34H48N6O5S and a molecular weight of 652.86 g/mol. Its IUPAC name is ethyl (2R)-1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-[3-(dimethylamino)propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]sulfonylamino]propanoyl]-4-methyl-3,6-dihydro-2H-pyridine-2-carboxylate.
| Compound Name | ethyl (2R)-1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-[3-(dimethylamino)propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]sulfonylamino]propanoyl]-4-methyl-3,6-dihydro-2H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 67692309 |
| Molecular Formula | C34H48N6O5S |
| Molecular Weight | 652.86 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | ethyl (2R)-1-[(2S)-3-(3-carbamimidoylphenyl)-2-[[3-[3-(dimethylamino)propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]sulfonylamino]propanoyl]-4-methyl-3,6-dihydro-2H-pyridine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2ccc3c(c2)CCN(CCCN(C)C)CC3)C(=O)N2CC=C(C)C[C@@H]2C(=O)OCC)c1 |
| InChI | InChI=1S/C34H48N6O5S/c1-5-45-34(42)31-20-24(2)12-19-40(31)33(41)30(22-25-8-6-9-28(21-25)32(35)36)37-46(43,44)29-11-10-26-13-17-39(16-7-15-38(3)4)18-14-27(26)23-29/h6,8-12,21,23,30-31,37H,5,7,13-20,22H2,1-4H3,(H3,35,36)/t30-,31+/m0/s1 |
| InChIKey | RAPFRYYKUWWPSJ-IOWSJCHKSA-N |
| XLogP | 2.32 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.86 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|