C27H33N5O5S — CID 67692465
1-[(2S)-3-(3-carbamimidoylphenyl)-2-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)sulfonylamino]propanoyl]-4-methyl-3,6-dihydro-2H-pyridine-2-carboxylic acid (PubChem CID 67692465) has the molecular formula C27H33N5O5S and a molecular weight of 539.66 g/mol. Its IUPAC name is 1-[(2S)-3-(3-carbamimidoylphenyl)-2-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)sulfonylamino]propanoyl]-4-methyl-3,6-dihydro-2H-pyridine-2-carboxylic acid.
| Compound Name | 1-[(2S)-3-(3-carbamimidoylphenyl)-2-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)sulfonylamino]propanoyl]-4-methyl-3,6-dihydro-2H-pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 67692465 |
| Molecular Formula | C27H33N5O5S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 1-[(2S)-3-(3-carbamimidoylphenyl)-2-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)sulfonylamino]propanoyl]-4-methyl-3,6-dihydro-2H-pyridine-2-carboxylic acid |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2ccc3c(c2)CN(C)CC3)C(=O)N2CC=C(C)CC2C(=O)O)c1 |
| InChI | InChI=1S/C27H33N5O5S/c1-17-8-11-32(24(12-17)27(34)35)26(33)23(14-18-4-3-5-20(13-18)25(28)29)30-38(36,37)22-7-6-19-9-10-31(2)16-21(19)15-22/h3-8,13,15,23-24,30H,9-12,14,16H2,1-2H3,(H3,28,29)(H,34,35)/t23-,24?/m0/s1 |
| InChIKey | BTAGSLRYBPKFGK-UXMRNZNESA-N |
| XLogP | 1.48 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|