C16H29N4+ — CID 67692662
dimethyl-[2-[methyl(piperidin-4-yl)amino]-3-pyridinyl]-propylazanium (PubChem CID 67692662) has the molecular formula C16H29N4+ and a molecular weight of 277.44 g/mol. Its IUPAC name is dimethyl-[2-[methyl(piperidin-4-yl)amino]-3-pyridinyl]-propylazanium.
| Compound Name | dimethyl-[2-[methyl(piperidin-4-yl)amino]-3-pyridinyl]-propylazanium |
|---|---|
| PubChem CID | 67692662 |
| Molecular Formula | C16H29N4+ |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | dimethyl-[2-[methyl(piperidin-4-yl)amino]-3-pyridinyl]-propylazanium |
| SMILES | CCC[N+](C)(C)c1cccnc1N(C)C1CCNCC1 |
| InChI | InChI=1S/C16H29N4/c1-5-13-20(3,4)15-7-6-10-18-16(15)19(2)14-8-11-17-12-9-14/h6-7,10,14,17H,5,8-9,11-13H2,1-4H3/q+1 |
| InChIKey | BLCGJKFSKHNXNQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|