C25H37F3N2O2 — CID 67693305
(1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-N-[3-(trifluoromethyl)but-3-en-2-yl]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxamide (PubChem CID 67693305) has the molecular formula C25H37F3N2O2 and a molecular weight of 454.58 g/mol. Its IUPAC name is (1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-N-[3-(trifluoromethyl)but-3-en-2-yl]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxamide.
| Compound Name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-N-[3-(trifluoromethyl)but-3-en-2-yl]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 67693305 |
| Molecular Formula | C25H37F3N2O2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-N-[3-(trifluoromethyl)but-3-en-2-yl]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxamide |
| SMILES | C=C(C(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4N(C)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C)C(F)(F)F |
| InChI | InChI=1S/C25H37F3N2O2/c1-14(25(26,27)28)15(2)29-22(32)19-8-7-17-16-6-9-20-24(4,13-11-21(31)30(20)5)18(16)10-12-23(17,19)3/h15-20H,1,6-13H2,2-5H3,(H,29,32)/t15?,16-,17-,18-,19+,20+,23-,24+/m0/s1 |
| InChIKey | RXSIXAYJAQSIOS-YXLHZPBBSA-N |
| XLogP | 5.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|