C25H37F3N2O2 — CID 67693344
(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-N-(1,1,1-trifluoro-3-methylbut-3-en-2-yl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxamide (PubChem CID 67693344) has the molecular formula C25H37F3N2O2 and a molecular weight of 454.58 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-N-(1,1,1-trifluoro-3-methylbut-3-en-2-yl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxamide.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-N-(1,1,1-trifluoro-3-methylbut-3-en-2-yl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 67693344 |
| Molecular Formula | C25H37F3N2O2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-N-(1,1,1-trifluoro-3-methylbut-3-en-2-yl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxamide |
| SMILES | C=C(C)C(NC(=O)C1CC[C@H]2[C@@H]3CCC4N(C)C(=O)CC[C@]4(C)[C@@H]3CC[C@]12C)C(F)(F)F |
| InChI | InChI=1S/C25H37F3N2O2/c1-14(2)21(25(26,27)28)29-22(32)18-8-7-16-15-6-9-19-24(4,13-11-20(31)30(19)5)17(15)10-12-23(16,18)3/h15-19,21H,1,6-13H2,2-5H3,(H,29,32)/t15-,16-,17+,18?,19?,21?,23-,24+/m0/s1 |
| InChIKey | FPKFOYQNMUVZBW-RVLGZHKTSA-N |
| XLogP | 5.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|