C20H20BrN3O2 — CID 67693712
2-bromo-N-[4-(4-imidazol-1-ylphenoxy)butyl]benzamide (PubChem CID 67693712) has the molecular formula C20H20BrN3O2 and a molecular weight of 414.30 g/mol. Its IUPAC name is 2-bromo-N-[4-(4-imidazol-1-ylphenoxy)butyl]benzamide.
| Compound Name | 2-bromo-N-[4-(4-imidazol-1-ylphenoxy)butyl]benzamide |
|---|---|
| PubChem CID | 67693712 |
| Molecular Formula | C20H20BrN3O2 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-bromo-N-[4-(4-imidazol-1-ylphenoxy)butyl]benzamide |
| SMILES | O=C(NCCCCOc1ccc(-n2ccnc2)cc1)c1ccccc1Br |
| InChI | InChI=1S/C20H20BrN3O2/c21-19-6-2-1-5-18(19)20(25)23-11-3-4-14-26-17-9-7-16(8-10-17)24-13-12-22-15-24/h1-2,5-10,12-13,15H,3-4,11,14H2,(H,23,25) |
| InChIKey | DDJRFTHHGLSBAQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|