C15H17ClFN5 — CID 67695128
6-(4-aminopiperidin-1-yl)-N-(3-chloro-4-fluorophenyl)pyrimidin-4-amine (PubChem CID 67695128) has the molecular formula C15H17ClFN5 and a molecular weight of 321.79 g/mol. Its IUPAC name is 6-(4-aminopiperidin-1-yl)-N-(3-chloro-4-fluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-(4-aminopiperidin-1-yl)-N-(3-chloro-4-fluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 67695128 |
| Molecular Formula | C15H17ClFN5 |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 6-(4-aminopiperidin-1-yl)-N-(3-chloro-4-fluorophenyl)pyrimidin-4-amine |
| SMILES | NC1CCN(c2cc(Nc3ccc(F)c(Cl)c3)ncn2)CC1 |
| InChI | InChI=1S/C15H17ClFN5/c16-12-7-11(1-2-13(12)17)21-14-8-15(20-9-19-14)22-5-3-10(18)4-6-22/h1-2,7-10H,3-6,18H2,(H,19,20,21) |
| InChIKey | GZFHSGMYQSXSRX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |