C17H20N2O5 — CID 67698283
ethyl 2-[(2R,3R)-1-acetyl-2-(benzylcarbamoyl)-4-oxoazetidin-3-yl]acetate (PubChem CID 67698283) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 2-[(2R,3R)-1-acetyl-2-(benzylcarbamoyl)-4-oxoazetidin-3-yl]acetate.
| Compound Name | ethyl 2-[(2R,3R)-1-acetyl-2-(benzylcarbamoyl)-4-oxoazetidin-3-yl]acetate |
|---|---|
| PubChem CID | 67698283 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl 2-[(2R,3R)-1-acetyl-2-(benzylcarbamoyl)-4-oxoazetidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C(=O)N(C(C)=O)[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H20N2O5/c1-3-24-14(21)9-13-15(19(11(2)20)17(13)23)16(22)18-10-12-7-5-4-6-8-12/h4-8,13,15H,3,9-10H2,1-2H3,(H,18,22)/t13-,15-/m1/s1 |
| InChIKey | WZSQGXJRCXJJDT-UKRRQHHQSA-N |
| XLogP | 0.63 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |