C31H35N5O4 — CID 67699345
[1-[[hexanoyl-[[6-[2-(2H-tetrazol-5-yl)phenyl]naphthalen-2-yl]methyl]amino]methyl]cyclopentyl] hydrogen carbonate (PubChem CID 67699345) has the molecular formula C31H35N5O4 and a molecular weight of 541.65 g/mol. Its IUPAC name is [1-[[hexanoyl-[[6-[2-(2H-tetrazol-5-yl)phenyl]naphthalen-2-yl]methyl]amino]methyl]cyclopentyl] hydrogen carbonate.
| Compound Name | [1-[[hexanoyl-[[6-[2-(2H-tetrazol-5-yl)phenyl]naphthalen-2-yl]methyl]amino]methyl]cyclopentyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67699345 |
| Molecular Formula | C31H35N5O4 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | [1-[[hexanoyl-[[6-[2-(2H-tetrazol-5-yl)phenyl]naphthalen-2-yl]methyl]amino]methyl]cyclopentyl] hydrogen carbonate |
| SMILES | CCCCCC(=O)N(Cc1ccc2cc(-c3ccccc3-c3nn[nH]n3)ccc2c1)CC1(OC(=O)O)CCCC1 |
| InChI | InChI=1S/C31H35N5O4/c1-2-3-4-11-28(37)36(21-31(40-30(38)39)16-7-8-17-31)20-22-12-13-24-19-25(15-14-23(24)18-22)26-9-5-6-10-27(26)29-32-34-35-33-29/h5-6,9-10,12-15,18-19H,2-4,7-8,11,16-17,20-21H2,1H3,(H,38,39)(H,32,33,34,35) |
| InChIKey | LFEZSBGVSBYHJC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|