C29H31NO6 — CID 67699224
2-[6-[[butanoyl-[(1-carboxyoxycyclopentyl)methyl]amino]methyl]naphthalen-2-yl]benzoic acid (PubChem CID 67699224) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is 2-[6-[[butanoyl-[(1-carboxyoxycyclopentyl)methyl]amino]methyl]naphthalen-2-yl]benzoic acid.
| Compound Name | 2-[6-[[butanoyl-[(1-carboxyoxycyclopentyl)methyl]amino]methyl]naphthalen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 67699224 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-[6-[[butanoyl-[(1-carboxyoxycyclopentyl)methyl]amino]methyl]naphthalen-2-yl]benzoic acid |
| SMILES | CCCC(=O)N(Cc1ccc2cc(-c3ccccc3C(=O)O)ccc2c1)CC1(OC(=O)O)CCCC1 |
| InChI | InChI=1S/C29H31NO6/c1-2-7-26(31)30(19-29(36-28(34)35)14-5-6-15-29)18-20-10-11-22-17-23(13-12-21(22)16-20)24-8-3-4-9-25(24)27(32)33/h3-4,8-13,16-17H,2,5-7,14-15,18-19H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | AIYQUDMVLARATM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |