C25H25NO6 — CID 22859908
2-[6-[[[(1S)-1-carboxyethyl]-propoxycarbonylamino]methyl]naphthalen-2-yl]benzoic acid (PubChem CID 22859908) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-[6-[[[(1S)-1-carboxyethyl]-propoxycarbonylamino]methyl]naphthalen-2-yl]benzoic acid.
| Compound Name | 2-[6-[[[(1S)-1-carboxyethyl]-propoxycarbonylamino]methyl]naphthalen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 22859908 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[6-[[[(1S)-1-carboxyethyl]-propoxycarbonylamino]methyl]naphthalen-2-yl]benzoic acid |
| SMILES | CCCOC(=O)N(Cc1ccc2cc(-c3ccccc3C(=O)O)ccc2c1)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C25H25NO6/c1-3-12-32-25(31)26(16(2)23(27)28)15-17-8-9-19-14-20(11-10-18(19)13-17)21-6-4-5-7-22(21)24(29)30/h4-11,13-14,16H,3,12,15H2,1-2H3,(H,27,28)(H,29,30)/t16-/m0/s1 |
| InChIKey | WVCMGKQNFBOKLD-INIZCTEOSA-N |
| XLogP | 5.03 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |