C26H27NO5 — CID 22859907
2-[6-[[[(1S)-1-carboxy-2-methylpropyl]-propanoylamino]methyl]naphthalen-2-yl]benzoic acid (PubChem CID 22859907) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 2-[6-[[[(1S)-1-carboxy-2-methylpropyl]-propanoylamino]methyl]naphthalen-2-yl]benzoic acid.
| Compound Name | 2-[6-[[[(1S)-1-carboxy-2-methylpropyl]-propanoylamino]methyl]naphthalen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 22859907 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[6-[[[(1S)-1-carboxy-2-methylpropyl]-propanoylamino]methyl]naphthalen-2-yl]benzoic acid |
| SMILES | CCC(=O)N(Cc1ccc2cc(-c3ccccc3C(=O)O)ccc2c1)[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C26H27NO5/c1-4-23(28)27(24(16(2)3)26(31)32)15-17-9-10-19-14-20(12-11-18(19)13-17)21-7-5-6-8-22(21)25(29)30/h5-14,16,24H,4,15H2,1-3H3,(H,29,30)(H,31,32)/t24-/m0/s1 |
| InChIKey | DZUNGJUAVYXCSU-DEOSSOPVSA-N |
| XLogP | 5.05 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |