About but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate
but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate (PubChem CID 67700416) has the molecular formula C30H24O5
and a molecular weight of 464.52 g/mol. Its IUPAC name is but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate.
Molecular Properties
| Compound Name | but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate |
| PubChem CID | 67700416 |
| Molecular Formula | C30H24O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate |
| SMILES | C=CC(C)OC(=O)c1ccccc1-c1ccc(-c2ccc(OC(=O)c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H24O5/c1-3-20(2)34-30(33)28-7-5-4-6-27(28)23-10-8-21(9-11-23)22-14-18-26(19-15-22)35-29(32)24-12-16-25(31)17-13-24/h3-20,31H,1H2,2H3 |
| InChIKey | SNQZVPPUERRWRI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate?
The IUPAC name of but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate (CID 67700416) is but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate.
What is the SMILES notation for but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate?
The canonical SMILES for but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate is C=CC(C)OC(=O)c1ccccc1-c1ccc(-c2ccc(OC(=O)c3ccc(O)cc3)cc2)cc1.
What is the InChIKey of but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate?
The InChIKey is SNQZVPPUERRWRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24O5/c1-3-20(2)34-30(33)28-7-5-4-6-27(28)23-10-8-21(9-11-23)22-14-18-26(19-15-22)35-29(32)24-12-16-25(31)17-13-24/h3-20,31H,1H2,2H3.
What are the key properties of but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate?
but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate has a molecular weight of 464.52 g/mol, XLogP of 6.68, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-yl 2-[4-[4-(4-hydroxybenzoyl)oxyphenyl]phenyl]benzoate is sourced from PubChem (CID 67700416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).