C17H22N2O2 — CID 67703543
butyl bicyclo[2.2.0]hexa-1,3,5-triene-2-carboxylate;piperidine-4-carbonitrile (PubChem CID 67703543) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is butyl bicyclo[2.2.0]hexa-1,3,5-triene-2-carboxylate;piperidine-4-carbonitrile.
| Compound Name | butyl bicyclo[2.2.0]hexa-1,3,5-triene-2-carboxylate;piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 67703543 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | butyl bicyclo[2.2.0]hexa-1,3,5-triene-2-carboxylate;piperidine-4-carbonitrile |
| SMILES | CCCCOC(=O)c1cc2ccc1-2.N#CC1CCNCC1 |
| InChI | InChI=1S/C11H12O2.C6H10N2/c1-2-3-6-13-11(12)10-7-8-4-5-9(8)10;7-5-6-1-3-8-4-2-6/h4-5,7H,2-3,6H2,1H3;6,8H,1-4H2 |
| InChIKey | UMSOYONNUXQZFA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|