C23H32ClN5O3 — CID 67704476
N,N,5-trimethyl-3-[4-(2-nitrophenyl)piperazin-1-yl]-2-(propylamino)benzamide;hydrochloride (PubChem CID 67704476) has the molecular formula C23H32ClN5O3 and a molecular weight of 461.99 g/mol. Its IUPAC name is N,N,5-trimethyl-3-[4-(2-nitrophenyl)piperazin-1-yl]-2-(propylamino)benzamide;hydrochloride.
| Compound Name | N,N,5-trimethyl-3-[4-(2-nitrophenyl)piperazin-1-yl]-2-(propylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 67704476 |
| Molecular Formula | C23H32ClN5O3 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | N,N,5-trimethyl-3-[4-(2-nitrophenyl)piperazin-1-yl]-2-(propylamino)benzamide;hydrochloride |
| SMILES | CCCNc1c(C(=O)N(C)C)cc(C)cc1N1CCN(c2ccccc2[N+](=O)[O-])CC1.Cl |
| InChI | InChI=1S/C23H31N5O3.ClH/c1-5-10-24-22-18(23(29)25(3)4)15-17(2)16-21(22)27-13-11-26(12-14-27)19-8-6-7-9-20(19)28(30)31;/h6-9,15-16,24H,5,10-14H2,1-4H3;1H |
| InChIKey | WOTGAFPCBFQIDZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|