C25H48N2O3 — CID 67710021
acetic acid;2-(2-octadec-9-enyl-4,5-dihydroimidazol-1-yl)ethanol (PubChem CID 67710021) has the molecular formula C25H48N2O3 and a molecular weight of 424.67 g/mol. Its IUPAC name is acetic acid;2-(2-octadec-9-enyl-4,5-dihydroimidazol-1-yl)ethanol.
| Compound Name | acetic acid;2-(2-octadec-9-enyl-4,5-dihydroimidazol-1-yl)ethanol |
|---|---|
| PubChem CID | 67710021 |
| Molecular Formula | C25H48N2O3 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | acetic acid;2-(2-octadec-9-enyl-4,5-dihydroimidazol-1-yl)ethanol |
| SMILES | CC(=O)O.CCCCCCCCC=CCCCCCCCCC1=NCCN1CCO |
| InChI | InChI=1S/C23H44N2O.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-24-19-20-25(23)21-22-26;1-2(3)4/h9-10,26H,2-8,11-22H2,1H3;1H3,(H,3,4) |
| InChIKey | QVEMLEZLFXITHM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|