C26H45N3O3 — CID 122367791
(E)-4-[2-[2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethylamino]-4-oxobut-2-enoic acid (PubChem CID 122367791) has the molecular formula C26H45N3O3 and a molecular weight of 447.66 g/mol. Its IUPAC name is (E)-4-[2-[2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-[2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 122367791 |
| Molecular Formula | C26H45N3O3 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | (E)-4-[2-[2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethylamino]-4-oxobut-2-enoic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCC1=NCCN1CCNC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C26H45N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24-27-20-22-29(24)23-21-28-25(30)18-19-26(31)32/h9-10,18-19H,2-8,11-17,20-23H2,1H3,(H,28,30)(H,31,32)/b10-9+,19-18+ |
| InChIKey | GBGKDEYXDYCXIB-KONNGCMJSA-N |
| XLogP | 5.49 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|