C25H46N2O3 — CID 3023578
3-[2-(2-heptadec-8-enyl-4,5-dihydroimidazol-1-yl)ethoxy]propanoic acid (PubChem CID 3023578) has the molecular formula C25H46N2O3 and a molecular weight of 422.65 g/mol. Its IUPAC name is 3-[2-(2-heptadec-8-enyl-4,5-dihydroimidazol-1-yl)ethoxy]propanoic acid.
| Compound Name | 3-[2-(2-heptadec-8-enyl-4,5-dihydroimidazol-1-yl)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 3023578 |
| Molecular Formula | C25H46N2O3 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.35 |
| IUPAC Name | 3-[2-(2-heptadec-8-enyl-4,5-dihydroimidazol-1-yl)ethoxy]propanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC1=NCCN1CCOCCC(=O)O |
| InChI | InChI=1S/C25H46N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24-26-19-20-27(24)21-23-30-22-18-25(28)29/h9-10H,2-8,11-23H2,1H3,(H,28,29) |
| InChIKey | HIUUYKQXGKZRNS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|