C38H68N2O4 — CID 67767246
18-[2-(16-carboxyhexadec-8-enyl)-4,5-dihydroimidazol-1-yl]octadec-9-enoic acid (PubChem CID 67767246) has the molecular formula C38H68N2O4 and a molecular weight of 616.97 g/mol. Its IUPAC name is 18-[2-(16-carboxyhexadec-8-enyl)-4,5-dihydroimidazol-1-yl]octadec-9-enoic acid.
| Compound Name | 18-[2-(16-carboxyhexadec-8-enyl)-4,5-dihydroimidazol-1-yl]octadec-9-enoic acid |
|---|---|
| PubChem CID | 67767246 |
| Molecular Formula | C38H68N2O4 |
| Molecular Weight | 616.97 g/mol |
| Exact Mass | 616.52 |
| IUPAC Name | 18-[2-(16-carboxyhexadec-8-enyl)-4,5-dihydroimidazol-1-yl]octadec-9-enoic acid |
| SMILES | O=C(O)CCCCCCCC=CCCCCCCCCN1CCN=C1CCCCCCCC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C38H68N2O4/c41-37(42)31-27-23-19-15-11-7-2-1-5-9-13-17-21-25-29-34-40-35-33-39-36(40)30-26-22-18-14-10-6-3-4-8-12-16-20-24-28-32-38(43)44/h1-4H,5-35H2,(H,41,42)(H,43,44) |
| InChIKey | OMJCRTVXEOJNFA-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.97 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|