C41H77N3O — CID 158731503
(9E)-N-[2-[2-[(Z)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethyl]-9-(2-methylcyclooctylidene)nonanamide;methane (PubChem CID 158731503) has the molecular formula C41H77N3O and a molecular weight of 628.09 g/mol. Its IUPAC name is (9E)-N-[2-[2-[(Z)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethyl]-9-(2-methylcyclooctylidene)nonanamide;methane.
| Compound Name | (9E)-N-[2-[2-[(Z)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethyl]-9-(2-methylcyclooctylidene)nonanamide;methane |
|---|---|
| PubChem CID | 158731503 |
| Molecular Formula | C41H77N3O |
| Molecular Weight | 628.09 g/mol |
| Exact Mass | 627.61 |
| IUPAC Name | (9E)-N-[2-[2-[(Z)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethyl]-9-(2-methylcyclooctylidene)nonanamide;methane |
| SMILES | C.CCCCCCCC/C=C\CCCCCCCC1=NCCN1CCNC(=O)CCCCCCC/C=C1\CCCCCCC1C |
| InChI | InChI=1S/C40H73N3O.CH4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-26-31-39-41-33-35-43(39)36-34-42-40(44)32-27-20-17-16-18-24-29-38-30-25-22-21-23-28-37(38)2;/h10-11,29,37H,3-9,12-28,30-36H2,1-2H3,(H,42,44);1H4/b11-10-,38-29+; |
| InChIKey | ILDQCISZBQLPNF-UUCLUFDTSA-N |
| XLogP | 12.14 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.09 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|