C14H13NO2S — CID 67712602
N-[3-[(E)-3-hydroxyprop-1-enyl]phenyl]thiophene-2-carboxamide (PubChem CID 67712602) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-[3-[(E)-3-hydroxyprop-1-enyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(E)-3-hydroxyprop-1-enyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 67712602 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N-[3-[(E)-3-hydroxyprop-1-enyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(/C=C/CO)c1)c1cccs1 |
| InChI | InChI=1S/C14H13NO2S/c16-8-2-5-11-4-1-6-12(10-11)15-14(17)13-7-3-9-18-13/h1-7,9-10,16H,8H2,(H,15,17)/b5-2+ |
| InChIKey | NLENAHQPCKFDRW-GORDUTHDSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |