C25H32O3 — CID 67713252
6-[3-[hydroxy-(4-pentylphenyl)methyl]phenyl]-2-methylhex-5-enoic acid (PubChem CID 67713252) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is 6-[3-[hydroxy-(4-pentylphenyl)methyl]phenyl]-2-methylhex-5-enoic acid.
| Compound Name | 6-[3-[hydroxy-(4-pentylphenyl)methyl]phenyl]-2-methylhex-5-enoic acid |
|---|---|
| PubChem CID | 67713252 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 6-[3-[hydroxy-(4-pentylphenyl)methyl]phenyl]-2-methylhex-5-enoic acid |
| SMILES | CCCCCc1ccc(C(O)c2cccc(C=CCCC(C)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C25H32O3/c1-3-4-5-10-20-14-16-22(17-15-20)24(26)23-13-8-12-21(18-23)11-7-6-9-19(2)25(27)28/h7-8,11-19,24,26H,3-6,9-10H2,1-2H3,(H,27,28) |
| InChIKey | RECRDNZSGRETAE-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|