C12H13FN2S — CID 677134
(4R)-4-(2-fluorophenyl)-5,6-dimethyl-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 677134) has the molecular formula C12H13FN2S and a molecular weight of 236.31 g/mol. Its IUPAC name is (4R)-4-(2-fluorophenyl)-5,6-dimethyl-3,4-dihydro-1H-pyrimidine-2-thione.
| Compound Name | (4R)-4-(2-fluorophenyl)-5,6-dimethyl-3,4-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 677134 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (4R)-4-(2-fluorophenyl)-5,6-dimethyl-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | CC1=C(C)[C@H](c2ccccc2F)NC(=S)N1 |
| InChI | InChI=1S/C12H13FN2S/c1-7-8(2)14-12(16)15-11(7)9-5-3-4-6-10(9)13/h3-6,11H,1-2H3,(H2,14,15,16)/t11-/m1/s1 |
| InChIKey | WDOSPDRAOFNONP-LLVKDONJSA-N |
| XLogP | 2.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|