C22H20F2N2S — CID 7255933
(4R,6R,8E)-4-(2-fluorophenyl)-8-[(2-fluorophenyl)methylidene]-6-methyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione (PubChem CID 7255933) has the molecular formula C22H20F2N2S and a molecular weight of 382.48 g/mol. Its IUPAC name is (4R,6R,8E)-4-(2-fluorophenyl)-8-[(2-fluorophenyl)methylidene]-6-methyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione.
| Compound Name | (4R,6R,8E)-4-(2-fluorophenyl)-8-[(2-fluorophenyl)methylidene]-6-methyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 7255933 |
| Molecular Formula | C22H20F2N2S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (4R,6R,8E)-4-(2-fluorophenyl)-8-[(2-fluorophenyl)methylidene]-6-methyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
| SMILES | C[C@H]1CC2=C(NC(=S)N[C@H]2c2ccccc2F)/C(=C/c2ccccc2F)C1 |
| InChI | InChI=1S/C22H20F2N2S/c1-13-10-15(12-14-6-2-4-8-18(14)23)20-17(11-13)21(26-22(27)25-20)16-7-3-5-9-19(16)24/h2-9,12-13,21H,10-11H2,1H3,(H2,25,26,27)/b15-12+/t13-,21+/m1/s1 |
| InChIKey | PADDBNBWCSSZHO-YXYNZYKKSA-N |
| XLogP | 5.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|