C31H29N3S — CID 2304582
(4R,8E)-4-naphthalen-1-yl-8-(naphthalen-1-ylmethylidene)-6-propyl-3,4,5,7-tetrahydro-1H-pyrido[4,3-d]pyrimidine-2-thione (PubChem CID 2304582) has the molecular formula C31H29N3S and a molecular weight of 475.66 g/mol. Its IUPAC name is (4R,8E)-4-naphthalen-1-yl-8-(naphthalen-1-ylmethylidene)-6-propyl-3,4,5,7-tetrahydro-1H-pyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | (4R,8E)-4-naphthalen-1-yl-8-(naphthalen-1-ylmethylidene)-6-propyl-3,4,5,7-tetrahydro-1H-pyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 2304582 |
| Molecular Formula | C31H29N3S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (4R,8E)-4-naphthalen-1-yl-8-(naphthalen-1-ylmethylidene)-6-propyl-3,4,5,7-tetrahydro-1H-pyrido[4,3-d]pyrimidine-2-thione |
| SMILES | CCCN1CC2=C(NC(=S)N[C@@H]2c2cccc3ccccc23)/C(=C/c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C31H29N3S/c1-2-17-34-19-24(18-23-13-7-11-21-9-3-5-14-25(21)23)29-28(20-34)30(33-31(35)32-29)27-16-8-12-22-10-4-6-15-26(22)27/h3-16,18,30H,2,17,19-20H2,1H3,(H2,32,33,35)/b24-18+/t30-/m1/s1 |
| InChIKey | CCBFBQSLGTZNJH-FTDJXNPMSA-N |
| XLogP | 6.58 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|