C23H24N2O2S — CID 6979932
(4R)-4-(2-methoxyphenyl)-8-[(2-methoxyphenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione (PubChem CID 6979932) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is (4R)-4-(2-methoxyphenyl)-8-[(2-methoxyphenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione.
| Compound Name | (4R)-4-(2-methoxyphenyl)-8-[(2-methoxyphenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 6979932 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (4R)-4-(2-methoxyphenyl)-8-[(2-methoxyphenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
| SMILES | COc1ccccc1C=C1CCCC2=C1NC(=S)N[C@H]2c1ccccc1OC |
| InChI | InChI=1S/C23H24N2O2S/c1-26-19-12-5-3-8-15(19)14-16-9-7-11-18-21(16)24-23(28)25-22(18)17-10-4-6-13-20(17)27-2/h3-6,8,10,12-14,22H,7,9,11H2,1-2H3,(H2,24,25,28)/t22-/m0/s1 |
| InChIKey | UOVYQKRGIODRFA-QFIPXVFZSA-N |
| XLogP | 4.74 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|