C26H28N2O3 — CID 7689450
[(3S,3aR,7E)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-cyclopropylmethanone (PubChem CID 7689450) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is [(3S,3aR,7E)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-cyclopropylmethanone.
| Compound Name | [(3S,3aR,7E)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 7689450 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [(3S,3aR,7E)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-cyclopropylmethanone |
| SMILES | COc1ccccc1/C=C1\CCC[C@H]2C1=NN(C(=O)C1CC1)[C@@H]2c1ccccc1OC |
| InChI | InChI=1S/C26H28N2O3/c1-30-22-12-5-3-8-18(22)16-19-9-7-11-21-24(19)27-28(26(29)17-14-15-17)25(21)20-10-4-6-13-23(20)31-2/h3-6,8,10,12-13,16-17,21,25H,7,9,11,14-15H2,1-2H3/b19-16+/t21-,25+/m0/s1 |
| InChIKey | LDBGZTMDCAXTSF-WJHVFECRSA-N |
| XLogP | 5.24 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |