C33H36N2O3 — CID 92949371
[(3S,3aS,7Z)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-tert-butylphenyl)methanone (PubChem CID 92949371) has the molecular formula C33H36N2O3 and a molecular weight of 508.66 g/mol. Its IUPAC name is [(3S,3aS,7Z)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-tert-butylphenyl)methanone.
| Compound Name | [(3S,3aS,7Z)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-tert-butylphenyl)methanone |
|---|---|
| PubChem CID | 92949371 |
| Molecular Formula | C33H36N2O3 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | [(3S,3aS,7Z)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-tert-butylphenyl)methanone |
| SMILES | COc1ccccc1/C=C1/CCC[C@@H]2C1=NN(C(=O)c1ccc(C(C)(C)C)cc1)[C@@H]2c1ccccc1OC |
| InChI | InChI=1S/C33H36N2O3/c1-33(2,3)25-19-17-22(18-20-25)32(36)35-31(26-13-7-9-16-29(26)38-5)27-14-10-12-24(30(27)34-35)21-23-11-6-8-15-28(23)37-4/h6-9,11,13,15-21,27,31H,10,12,14H2,1-5H3/b24-21-/t27-,31-/m1/s1 |
| InChIKey | KOGBODDJLIAIPB-KOWCZUKSSA-N |
| XLogP | 7.44 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |