C27H25Cl2N3O2S — CID 98675533
ethyl 2-[(3R,3aR,7Z)-3-(2-chlorophenyl)-7-[(2-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 98675533) has the molecular formula C27H25Cl2N3O2S and a molecular weight of 526.49 g/mol. Its IUPAC name is ethyl 2-[(3R,3aR,7Z)-3-(2-chlorophenyl)-7-[(2-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(3R,3aR,7Z)-3-(2-chlorophenyl)-7-[(2-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98675533 |
| Molecular Formula | C27H25Cl2N3O2S |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | ethyl 2-[(3R,3aR,7Z)-3-(2-chlorophenyl)-7-[(2-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2N=C3/C(=C\c4ccccc4Cl)CCC[C@@H]3[C@@H]2c2ccccc2Cl)nc1C |
| InChI | InChI=1S/C27H25Cl2N3O2S/c1-3-34-26(33)25-16(2)30-27(35-25)32-24(19-11-5-7-14-22(19)29)20-12-8-10-18(23(20)31-32)15-17-9-4-6-13-21(17)28/h4-7,9,11,13-15,20,24H,3,8,10,12H2,1-2H3/b18-15-/t20-,24-/m0/s1 |
| InChIKey | XQCKTWAZUVVURB-HGMDASCUSA-N |
| XLogP | 7.74 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |