C27H26Cl2N4OS — CID 75408889
2-[(7Z)-3-(2-chlorophenyl)-7-[(2-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 75408889) has the molecular formula C27H26Cl2N4OS and a molecular weight of 525.51 g/mol. Its IUPAC name is 2-[(7Z)-3-(2-chlorophenyl)-7-[(2-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(7Z)-3-(2-chlorophenyl)-7-[(2-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 75408889 |
| Molecular Formula | C27H26Cl2N4OS |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 2-[(7Z)-3-(2-chlorophenyl)-7-[(2-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N2N=C3/C(=C\c4ccccc4Cl)CCCC3C2c2ccccc2Cl)sc1C(=O)N(C)C |
| InChI | InChI=1S/C27H26Cl2N4OS/c1-16-25(26(34)32(2)3)35-27(30-16)33-24(19-11-5-7-14-22(19)29)20-12-8-10-18(23(20)31-33)15-17-9-4-6-13-21(17)28/h4-7,9,11,13-15,20,24H,8,10,12H2,1-3H3/b18-15- |
| InChIKey | WMSHLNTWQNLTDV-SDXDJHTJSA-N |
| XLogP | 7.26 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |