C27H25Br2N3O2S — CID 97354326
ethyl 2-[(3S,3aS,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 97354326) has the molecular formula C27H25Br2N3O2S and a molecular weight of 615.39 g/mol. Its IUPAC name is ethyl 2-[(3S,3aS,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(3S,3aS,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 97354326 |
| Molecular Formula | C27H25Br2N3O2S |
| Molecular Weight | 615.39 g/mol |
| Exact Mass | 613.00 |
| IUPAC Name | ethyl 2-[(3S,3aS,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2N=C3/C(=C\c4ccc(Br)cc4)CCC[C@H]3[C@H]2c2ccc(Br)cc2)nc1C |
| InChI | InChI=1S/C27H25Br2N3O2S/c1-3-34-26(33)25-16(2)30-27(35-25)32-24(18-9-13-21(29)14-10-18)22-6-4-5-19(23(22)31-32)15-17-7-11-20(28)12-8-17/h7-15,22,24H,3-6H2,1-2H3/b19-15-/t22-,24-/m1/s1 |
| InChIKey | BYJMKMSLGWKHED-VCLWAVCTSA-N |
| XLogP | 7.95 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.39 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |